C13H9ClO5 — CID 88595944
(3-chlorophenyl) 3,4,5-trihydroxybenzoate (PubChem CID 88595944) has the molecular formula C13H9ClO5 and a molecular weight of 280.66 g/mol. Its IUPAC name is (3-chlorophenyl) 3,4,5-trihydroxybenzoate.
| Compound Name | (3-chlorophenyl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 88595944 |
| Molecular Formula | C13H9ClO5 |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (3-chlorophenyl) 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1cccc(Cl)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H9ClO5/c14-8-2-1-3-9(6-8)19-13(18)7-4-10(15)12(17)11(16)5-7/h1-6,15-17H |
| InChIKey | OTHAPMJEHBRJCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|