About (3-chlorophenyl) 3-methylbut-2-enoate
(3-chlorophenyl) 3-methylbut-2-enoate (PubChem CID 12733013) has the molecular formula C11H11ClO2
and a molecular weight of 210.66 g/mol. Its IUPAC name is (3-chlorophenyl) 3-methylbut-2-enoate.
Molecular Properties
| Compound Name | (3-chlorophenyl) 3-methylbut-2-enoate |
| PubChem CID | 12733013 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (3-chlorophenyl) 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClO2/c1-8(2)6-11(13)14-10-5-3-4-9(12)7-10/h3-7H,1-2H3 |
| InChIKey | IPHQZCVDPSYWOR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl) 3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl) 3-methylbut-2-enoate?
The IUPAC name of (3-chlorophenyl) 3-methylbut-2-enoate (CID 12733013) is (3-chlorophenyl) 3-methylbut-2-enoate.
What is the SMILES notation for (3-chlorophenyl) 3-methylbut-2-enoate?
The canonical SMILES for (3-chlorophenyl) 3-methylbut-2-enoate is CC(C)=CC(=O)Oc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl) 3-methylbut-2-enoate?
The InChIKey is IPHQZCVDPSYWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO2/c1-8(2)6-11(13)14-10-5-3-4-9(12)7-10/h3-7H,1-2H3.
What are the key properties of (3-chlorophenyl) 3-methylbut-2-enoate?
(3-chlorophenyl) 3-methylbut-2-enoate has a molecular weight of 210.66 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl) 3-methylbut-2-enoate is sourced from PubChem (CID 12733013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).