C24H16O10 — CID 25157655
[6-(3,4,5-trihydroxybenzoyl)oxynaphthalen-2-yl] 3,4,5-trihydroxybenzoate (PubChem CID 25157655) has the molecular formula C24H16O10 and a molecular weight of 464.38 g/mol. Its IUPAC name is [6-(3,4,5-trihydroxybenzoyl)oxynaphthalen-2-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [6-(3,4,5-trihydroxybenzoyl)oxynaphthalen-2-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 25157655 |
| Molecular Formula | C24H16O10 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | [6-(3,4,5-trihydroxybenzoyl)oxynaphthalen-2-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1ccc2cc(OC(=O)c3cc(O)c(O)c(O)c3)ccc2c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C24H16O10/c25-17-7-13(8-18(26)21(17)29)23(31)33-15-3-1-11-5-16(4-2-12(11)6-15)34-24(32)14-9-19(27)22(30)20(28)10-14/h1-10,25-30H |
| InChIKey | RAIPJGBTULJXSU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|