C28H20O11 — CID 85130163
[3-[2-(4-hydroxyphenyl)ethenyl]-5-(3,4,5-trihydroxybenzoyl)oxyphenyl] 3,4,5-trihydroxybenzoate (PubChem CID 85130163) has the molecular formula C28H20O11 and a molecular weight of 532.46 g/mol. Its IUPAC name is [3-[2-(4-hydroxyphenyl)ethenyl]-5-(3,4,5-trihydroxybenzoyl)oxyphenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3-[2-(4-hydroxyphenyl)ethenyl]-5-(3,4,5-trihydroxybenzoyl)oxyphenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 85130163 |
| Molecular Formula | C28H20O11 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | [3-[2-(4-hydroxyphenyl)ethenyl]-5-(3,4,5-trihydroxybenzoyl)oxyphenyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1cc(C=Cc2ccc(O)cc2)cc(OC(=O)c2cc(O)c(O)c(O)c2)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C28H20O11/c29-18-5-3-14(4-6-18)1-2-15-7-19(38-27(36)16-9-21(30)25(34)22(31)10-16)13-20(8-15)39-28(37)17-11-23(32)26(35)24(33)12-17/h1-13,29-35H |
| InChIKey | MQCYNKJMVXBXQV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|