C20H20O3 — CID 174686350
4-[(E)-2-[3,5-bis(prop-2-enoxy)phenyl]ethenyl]phenol (PubChem CID 174686350) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis(prop-2-enoxy)phenyl]ethenyl]phenol.
| Compound Name | 4-[(E)-2-[3,5-bis(prop-2-enoxy)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 174686350 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[(E)-2-[3,5-bis(prop-2-enoxy)phenyl]ethenyl]phenol |
| SMILES | C=CCOc1cc(/C=C/c2ccc(O)cc2)cc(OCC=C)c1 |
| InChI | InChI=1S/C20H20O3/c1-3-11-22-19-13-17(14-20(15-19)23-12-4-2)6-5-16-7-9-18(21)10-8-16/h3-10,13-15,21H,1-2,11-12H2/b6-5+ |
| InChIKey | IDTOUZBBJVBRSO-AATRIKPKSA-N |
| XLogP | 4.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|