C35H34O4 — CID 118013728
4-[1,2,2-tris(4-prop-2-enoxyphenyl)ethyl]phenol (PubChem CID 118013728) has the molecular formula C35H34O4 and a molecular weight of 518.65 g/mol. Its IUPAC name is 4-[1,2,2-tris(4-prop-2-enoxyphenyl)ethyl]phenol.
| Compound Name | 4-[1,2,2-tris(4-prop-2-enoxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 118013728 |
| Molecular Formula | C35H34O4 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 4-[1,2,2-tris(4-prop-2-enoxyphenyl)ethyl]phenol |
| SMILES | C=CCOc1ccc(C(c2ccc(O)cc2)C(c2ccc(OCC=C)cc2)c2ccc(OCC=C)cc2)cc1 |
| InChI | InChI=1S/C35H34O4/c1-4-23-37-31-17-9-27(10-18-31)34(26-7-15-30(36)16-8-26)35(28-11-19-32(20-12-28)38-24-5-2)29-13-21-33(22-14-29)39-25-6-3/h4-22,34-36H,1-3,23-25H2 |
| InChIKey | RSLXZPHPYZGJBF-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|