C11H11F3O2 — CID 71494810
(1R)-2,2,2-trifluoro-1-(4-prop-2-enoxyphenyl)ethanol (PubChem CID 71494810) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(4-prop-2-enoxyphenyl)ethanol.
| Compound Name | (1R)-2,2,2-trifluoro-1-(4-prop-2-enoxyphenyl)ethanol |
|---|---|
| PubChem CID | 71494810 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(4-prop-2-enoxyphenyl)ethanol |
| SMILES | C=CCOc1ccc([C@@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O2/c1-2-7-16-9-5-3-8(4-6-9)10(15)11(12,13)14/h2-6,10,15H,1,7H2/t10-/m1/s1 |
| InChIKey | BUAYNTGABXSKDI-SNVBAGLBSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|