About 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol
4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol (PubChem CID 11021882) has the molecular formula C14H11F3O2
and a molecular weight of 268.23 g/mol. Its IUPAC name is 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol.
Molecular Properties
| Compound Name | 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol |
| PubChem CID | 11021882 |
| Molecular Formula | C14H11F3O2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol |
| SMILES | Oc1ccc(-c2ccc([C@H](O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H11F3O2/c15-14(16,17)13(19)11-3-1-9(2-4-11)10-5-7-12(18)8-6-10/h1-8,13,18-19H/t13-/m0/s1 |
| InChIKey | KCKPRUYAMDAPHF-ZDUSSCGKSA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol?
The IUPAC name of 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol (CID 11021882) is 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol.
What is the SMILES notation for 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol?
The canonical SMILES for 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol is Oc1ccc(-c2ccc([C@H](O)C(F)(F)F)cc2)cc1.
What is the InChIKey of 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol?
The InChIKey is KCKPRUYAMDAPHF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H11F3O2/c15-14(16,17)13(19)11-3-1-9(2-4-11)10-5-7-12(18)8-6-10/h1-8,13,18-19H/t13-/m0/s1.
What are the key properties of 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol?
4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol has a molecular weight of 268.23 g/mol, XLogP of 3.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenol is sourced from PubChem (CID 11021882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).