C10H12F3NO — CID 11413331
(1S)-1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanol (PubChem CID 11413331) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is (1S)-1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanol.
| Compound Name | (1S)-1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 11413331 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (1S)-1-[4-(dimethylamino)phenyl]-2,2,2-trifluoroethanol |
| SMILES | CN(C)c1ccc([C@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3NO/c1-14(2)8-5-3-7(4-6-8)9(15)10(11,12)13/h3-6,9,15H,1-2H3/t9-/m0/s1 |
| InChIKey | SOYRNYDJSIZAFO-VIFPVBQESA-N |
| XLogP | 2.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|