C12H21N — CID 161012849
N,N-dimethyl-4-propan-2-ylaniline;methane (PubChem CID 161012849) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N,N-dimethyl-4-propan-2-ylaniline;methane.
| Compound Name | N,N-dimethyl-4-propan-2-ylaniline;methane |
|---|---|
| PubChem CID | 161012849 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N,N-dimethyl-4-propan-2-ylaniline;methane |
| SMILES | C.CC(C)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C11H17N.CH4/c1-9(2)10-5-7-11(8-6-10)12(3)4;/h5-9H,1-4H3;1H4 |
| InChIKey | TXIUNXTUNHHOFE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|