C10H16N2 — CID 14341957
4-[(1R)-1-aminoethyl]-N,N-dimethylaniline (PubChem CID 14341957) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-[(1R)-1-aminoethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1R)-1-aminoethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 14341957 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4-[(1R)-1-aminoethyl]-N,N-dimethylaniline |
| SMILES | C[C@@H](N)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C10H16N2/c1-8(11)9-4-6-10(7-5-9)12(2)3/h4-8H,11H2,1-3H3/t8-/m1/s1 |
| InChIKey | VDOKYXHLVQGSJQ-MRVPVSSYSA-N |
| XLogP | 1.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|