C11H18N2 — CID 60965190
4-(1-aminopropan-2-yl)-N,N-dimethylaniline (PubChem CID 60965190) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(1-aminopropan-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 60965190 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-N,N-dimethylaniline |
| SMILES | CC(CN)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C11H18N2/c1-9(8-12)10-4-6-11(7-5-10)13(2)3/h4-7,9H,8,12H2,1-3H3 |
| InChIKey | PALPJAUFQVUYJI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|