C17H23N3 — CID 16793153
1-[4-(dimethylamino)phenyl]-N-methyl-N-phenylethane-1,2-diamine (PubChem CID 16793153) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-N-methyl-N-phenylethane-1,2-diamine.
| Compound Name | 1-[4-(dimethylamino)phenyl]-N-methyl-N-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 16793153 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-N-methyl-N-phenylethane-1,2-diamine |
| SMILES | CN(C)c1ccc(C(CN)N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H23N3/c1-19(2)15-11-9-14(10-12-15)17(13-18)20(3)16-7-5-4-6-8-16/h4-12,17H,13,18H2,1-3H3 |
| InChIKey | XZNDZIWNMPYZAV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|