About N,N-dimethylaniline
N,N-dimethylaniline (PubChem CID 70392672) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is N,N-dimethylaniline.
Molecular Properties
| Compound Name | N,N-dimethylaniline |
| PubChem CID | 70392672 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1.CN(C)c1ccccc1 |
| InChI | InChI=1S/2C8H11N/c2*1-9(2)8-6-4-3-5-7-8/h2*3-7H,1-2H3 |
| InChIKey | ICLMZQVLRKSOSJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline?
The IUPAC name of N,N-dimethylaniline (CID 70392672) is N,N-dimethylaniline.
What is the SMILES notation for N,N-dimethylaniline?
The canonical SMILES for N,N-dimethylaniline is CN(C)c1ccccc1.CN(C)c1ccccc1.
What is the InChIKey of N,N-dimethylaniline?
The InChIKey is ICLMZQVLRKSOSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H11N/c2*1-9(2)8-6-4-3-5-7-8/h2*3-7H,1-2H3.
What are the key properties of N,N-dimethylaniline?
N,N-dimethylaniline has a molecular weight of 242.37 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline is sourced from PubChem (CID 70392672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).