About N,N-dimethylaniline;methanol
N,N-dimethylaniline;methanol (PubChem CID 143205399) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N,N-dimethylaniline;methanol.
Molecular Properties
| Compound Name | N,N-dimethylaniline;methanol |
| PubChem CID | 143205399 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N,N-dimethylaniline;methanol |
| SMILES | CN(C)c1ccccc1.CO |
| InChI | InChI=1S/C8H11N.CH4O/c1-9(2)8-6-4-3-5-7-8;1-2/h3-7H,1-2H3;2H,1H3 |
| InChIKey | SLGWVDATGFHTQJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylaniline;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;methanol?
The IUPAC name of N,N-dimethylaniline;methanol (CID 143205399) is N,N-dimethylaniline;methanol.
What is the SMILES notation for N,N-dimethylaniline;methanol?
The canonical SMILES for N,N-dimethylaniline;methanol is CN(C)c1ccccc1.CO.
What is the InChIKey of N,N-dimethylaniline;methanol?
The InChIKey is SLGWVDATGFHTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.CH4O/c1-9(2)8-6-4-3-5-7-8;1-2/h3-7H,1-2H3;2H,1H3.
What are the key properties of N,N-dimethylaniline;methanol?
N,N-dimethylaniline;methanol has a molecular weight of 153.22 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;methanol is sourced from PubChem (CID 143205399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).