About N,N-dimethylaniline;mercury
N,N-dimethylaniline;mercury (PubChem CID 158660084) has the molecular formula C8H11HgN
and a molecular weight of 321.77 g/mol. Its IUPAC name is N,N-dimethylaniline;mercury.
Molecular Properties
| Compound Name | N,N-dimethylaniline;mercury |
| PubChem CID | 158660084 |
| Molecular Formula | C8H11HgN |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N,N-dimethylaniline;mercury |
| SMILES | CN(C)c1ccccc1.[Hg] |
| InChI | InChI=1S/C8H11N.Hg/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3; |
| InChIKey | ICQKSPFSNQIENS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylaniline;mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;mercury?
The IUPAC name of N,N-dimethylaniline;mercury (CID 158660084) is N,N-dimethylaniline;mercury.
What is the SMILES notation for N,N-dimethylaniline;mercury?
The canonical SMILES for N,N-dimethylaniline;mercury is CN(C)c1ccccc1.[Hg].
What is the InChIKey of N,N-dimethylaniline;mercury?
The InChIKey is ICQKSPFSNQIENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.Hg/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;.
What are the key properties of N,N-dimethylaniline;mercury?
N,N-dimethylaniline;mercury has a molecular weight of 321.77 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;mercury is sourced from PubChem (CID 158660084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).