About azanylidyneazanium;N,N-dimethylaniline;chloride
azanylidyneazanium;N,N-dimethylaniline;chloride (PubChem CID 23457952) has the molecular formula C8H12ClN3
and a molecular weight of 185.66 g/mol. Its IUPAC name is azanylidyneazanium;N,N-dimethylaniline;chloride.
Molecular Properties
| Compound Name | azanylidyneazanium;N,N-dimethylaniline;chloride |
| PubChem CID | 23457952 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | azanylidyneazanium;N,N-dimethylaniline;chloride |
| SMILES | CN(C)c1ccccc1.N#[NH+].[Cl-] |
| InChI | InChI=1S/C8H11N.ClH.N2/c1-9(2)8-6-4-3-5-7-8;;1-2/h3-7H,1-2H3;1H; |
| InChIKey | FKCNPJNRHCUFTE-UHFFFAOYSA-N |
| XLogP | -2.96 |
| TPSA | 50.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze azanylidyneazanium;N,N-dimethylaniline;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyneazanium;N,N-dimethylaniline;chloride?
The IUPAC name of azanylidyneazanium;N,N-dimethylaniline;chloride (CID 23457952) is azanylidyneazanium;N,N-dimethylaniline;chloride.
What is the SMILES notation for azanylidyneazanium;N,N-dimethylaniline;chloride?
The canonical SMILES for azanylidyneazanium;N,N-dimethylaniline;chloride is CN(C)c1ccccc1.N#[NH+].[Cl-].
What is the InChIKey of azanylidyneazanium;N,N-dimethylaniline;chloride?
The InChIKey is FKCNPJNRHCUFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.ClH.N2/c1-9(2)8-6-4-3-5-7-8;;1-2/h3-7H,1-2H3;1H;.
What are the key properties of azanylidyneazanium;N,N-dimethylaniline;chloride?
azanylidyneazanium;N,N-dimethylaniline;chloride has a molecular weight of 185.66 g/mol, XLogP of -2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneazanium;N,N-dimethylaniline;chloride is sourced from PubChem (CID 23457952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).