About N,N-dimethylaniline;hydron
N,N-dimethylaniline;hydron (PubChem CID 174471199) has the molecular formula C8H12N+
and a molecular weight of 122.19 g/mol. Its IUPAC name is N,N-dimethylaniline;hydron.
Molecular Properties
| Compound Name | N,N-dimethylaniline;hydron |
| PubChem CID | 174471199 |
| Molecular Formula | C8H12N+ |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.10 |
| IUPAC Name | N,N-dimethylaniline;hydron |
| SMILES | CN(C)c1ccccc1.[H+] |
| InChI | InChI=1S/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3/p+1 |
| InChIKey | JLTDJTHDQAWBAV-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylaniline;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylaniline;hydron?
The IUPAC name of N,N-dimethylaniline;hydron (CID 174471199) is N,N-dimethylaniline;hydron.
What is the SMILES notation for N,N-dimethylaniline;hydron?
The canonical SMILES for N,N-dimethylaniline;hydron is CN(C)c1ccccc1.[H+].
What is the InChIKey of N,N-dimethylaniline;hydron?
The InChIKey is JLTDJTHDQAWBAV-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3/p+1.
What are the key properties of N,N-dimethylaniline;hydron?
N,N-dimethylaniline;hydron has a molecular weight of 122.19 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylaniline;hydron is sourced from PubChem (CID 174471199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).