C10H15N — CID 7061
N,N-diethylaniline (PubChem CID 7061) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N,N-diethylaniline.
| Compound Name | N,N-diethylaniline |
|---|---|
| PubChem CID | 7061 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N,N-diethylaniline |
| SMILES | CCN(CC)c1ccccc1 |
| InChI | InChI=1S/C10H15N/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | GGSUCNLOZRCGPQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |