C28H29NPb — CID 4999017
N,N-diethyl-4-triphenylplumbylaniline (PubChem CID 4999017) has the molecular formula C28H29NPb and a molecular weight of 586.75 g/mol. Its IUPAC name is N,N-diethyl-4-triphenylplumbylaniline.
| Compound Name | N,N-diethyl-4-triphenylplumbylaniline |
|---|---|
| PubChem CID | 4999017 |
| Molecular Formula | C28H29NPb |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | N,N-diethyl-4-triphenylplumbylaniline |
| SMILES | CCN(CC)c1ccc([Pb](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C10H14N.3C6H5.Pb/c1-3-11(4-2)10-8-6-5-7-9-10;3*1-2-4-6-5-3-1;/h6-9H,3-4H2,1-2H3;3*1-5H; |
| InChIKey | DAUSYACCYYEMII-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |