C37H47N3 — CID 59366408
4-[bis[4-(diethylamino)phenyl]-phenylmethyl]-N,N-diethylaniline (PubChem CID 59366408) has the molecular formula C37H47N3 and a molecular weight of 533.80 g/mol. Its IUPAC name is 4-[bis[4-(diethylamino)phenyl]-phenylmethyl]-N,N-diethylaniline.
| Compound Name | 4-[bis[4-(diethylamino)phenyl]-phenylmethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 59366408 |
| Molecular Formula | C37H47N3 |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | 4-[bis[4-(diethylamino)phenyl]-phenylmethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccccc2)(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C37H47N3/c1-7-38(8-2)34-24-18-31(19-25-34)37(30-16-14-13-15-17-30,32-20-26-35(27-21-32)39(9-3)10-4)33-22-28-36(29-23-33)40(11-5)12-6/h13-29H,7-12H2,1-6H3 |
| InChIKey | GNGOLBKKAAJSLV-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|