C14H23N — CID 10632068
4-tert-butyl-N,N-diethylaniline (PubChem CID 10632068) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 4-tert-butyl-N,N-diethylaniline.
| Compound Name | 4-tert-butyl-N,N-diethylaniline |
|---|---|
| PubChem CID | 10632068 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 4-tert-butyl-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H23N/c1-6-15(7-2)13-10-8-12(9-11-13)14(3,4)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | SFAHTJULMBNOGW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |