C22H32N2O — CID 54796289
1-N-[2-(4-tert-butylphenoxy)ethyl]-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 54796289) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-N-[2-(4-tert-butylphenoxy)ethyl]-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 1-N-[2-(4-tert-butylphenoxy)ethyl]-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 54796289 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 1-N-[2-(4-tert-butylphenoxy)ethyl]-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(NCCOc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H32N2O/c1-6-24(7-2)20-12-10-19(11-13-20)23-16-17-25-21-14-8-18(9-15-21)22(3,4)5/h8-15,23H,6-7,16-17H2,1-5H3 |
| InChIKey | YXNSDXBVCODBGI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|