C16H25NO2 — CID 82318878
3-(4-tert-butyl-N-ethylanilino)-2-methylpropanoic acid (PubChem CID 82318878) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-(4-tert-butyl-N-ethylanilino)-2-methylpropanoic acid.
| Compound Name | 3-(4-tert-butyl-N-ethylanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82318878 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 3-(4-tert-butyl-N-ethylanilino)-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-6-17(11-12(2)15(18)19)14-9-7-13(8-10-14)16(3,4)5/h7-10,12H,6,11H2,1-5H3,(H,18,19) |
| InChIKey | OAUOIHDMYHQSSB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |