C23H30N2O — CID 5015585
3-(4-tert-butylphenyl)-N-[4-(diethylamino)phenyl]prop-2-enamide (PubChem CID 5015585) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[4-(diethylamino)phenyl]prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[4-(diethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5015585 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[4-(diethylamino)phenyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C=Cc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O/c1-6-25(7-2)21-15-13-20(14-16-21)24-22(26)17-10-18-8-11-19(12-9-18)23(3,4)5/h8-17H,6-7H2,1-5H3,(H,24,26) |
| InChIKey | YTOLOCICKSCVJR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|