C20H20F3NO — CID 7914020
(E)-N-(4-tert-butylphenyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 7914020) has the molecular formula C20H20F3NO and a molecular weight of 347.38 g/mol. Its IUPAC name is (E)-N-(4-tert-butylphenyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-tert-butylphenyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7914020 |
| Molecular Formula | C20H20F3NO |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (E)-N-(4-tert-butylphenyl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)/C=C/c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H20F3NO/c1-19(2,3)15-9-11-17(12-10-15)24-18(25)13-6-14-4-7-16(8-5-14)20(21,22)23/h4-13H,1-3H3,(H,24,25)/b13-6+ |
| InChIKey | ZKOYORFZRCOXOG-AWNIVKPZSA-N |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|