C17H11F6NO2 — CID 7957160
(E)-N-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 7957160) has the molecular formula C17H11F6NO2 and a molecular weight of 375.27 g/mol. Its IUPAC name is (E)-N-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7957160 |
| Molecular Formula | C17H11F6NO2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (E)-N-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F6NO2/c18-16(19,20)12-4-1-11(2-5-12)3-10-15(25)24-13-6-8-14(9-7-13)26-17(21,22)23/h1-10H,(H,24,25)/b10-3+ |
| InChIKey | WMGGZCQPPLPNHQ-XCVCLJGOSA-N |
| XLogP | 5.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|