C16H13F3N2O — CID 84553251
(E)-3-(4-aminophenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 84553251) has the molecular formula C16H13F3N2O and a molecular weight of 306.29 g/mol. Its IUPAC name is (E)-3-(4-aminophenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-aminophenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 84553251 |
| Molecular Formula | C16H13F3N2O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (E)-3-(4-aminophenyl)-N-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Nc1ccc(/C=C/C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H13F3N2O/c17-16(18,19)12-4-8-14(9-5-12)21-15(22)10-3-11-1-6-13(20)7-2-11/h1-10H,20H2,(H,21,22)/b10-3+ |
| InChIKey | XBLQBSNFFWYVRY-XCVCLJGOSA-N |
| XLogP | 3.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|