C19H18F3N3OS — CID 142253716
(E)-N-(2-amino-1,3-benzothiazol-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;ethane (PubChem CID 142253716) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is (E)-N-(2-amino-1,3-benzothiazol-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;ethane.
| Compound Name | (E)-N-(2-amino-1,3-benzothiazol-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 142253716 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (E)-N-(2-amino-1,3-benzothiazol-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide;ethane |
| SMILES | CC.Nc1nc2ccc(NC(=O)/C=C/c3ccc(C(F)(F)F)cc3)cc2s1 |
| InChI | InChI=1S/C17H12F3N3OS.C2H6/c18-17(19,20)11-4-1-10(2-5-11)3-8-15(24)22-12-6-7-13-14(9-12)25-16(21)23-13;1-2/h1-9H,(H2,21,23)(H,22,24);1-2H3/b8-3+; |
| InChIKey | JCOHQHKGNHBCOM-DCDCITSCSA-N |
| XLogP | 5.58 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|