C18H19N3OS — CID 50882062
N-(2-amino-1,3-benzothiazol-6-yl)-4-tert-butylbenzamide (PubChem CID 50882062) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is N-(2-amino-1,3-benzothiazol-6-yl)-4-tert-butylbenzamide.
| Compound Name | N-(2-amino-1,3-benzothiazol-6-yl)-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 50882062 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-(2-amino-1,3-benzothiazol-6-yl)-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc3nc(N)sc3c2)cc1 |
| InChI | InChI=1S/C18H19N3OS/c1-18(2,3)12-6-4-11(5-7-12)16(22)20-13-8-9-14-15(10-13)23-17(19)21-14/h4-10H,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | DVTBTFORGMKVKN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |