C20H19F3N2O2 — CID 26679746
2-methyl-N-[4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenyl]propanamide (PubChem CID 26679746) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-methyl-N-[4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 26679746 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-methyl-N-[4-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(NC(=O)/C=C/c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H19F3N2O2/c1-13(2)19(27)25-17-10-8-16(9-11-17)24-18(26)12-5-14-3-6-15(7-4-14)20(21,22)23/h3-13H,1-2H3,(H,24,26)(H,25,27)/b12-5+ |
| InChIKey | TYJWJKZYNXHFLS-LFYBBSHMSA-N |
| XLogP | 4.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|