C18H17N3O4 — CID 84552256
2-[[4-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]benzoyl]amino]acetic acid (PubChem CID 84552256) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[[4-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 84552256 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[[4-[[(E)-3-(4-aminophenyl)prop-2-enoyl]amino]benzoyl]amino]acetic acid |
| SMILES | Nc1ccc(/C=C/C(=O)Nc2ccc(C(=O)NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O4/c19-14-6-1-12(2-7-14)3-10-16(22)21-15-8-4-13(5-9-15)18(25)20-11-17(23)24/h1-10H,11,19H2,(H,20,25)(H,21,22)(H,23,24)/b10-3+ |
| InChIKey | SIZHVBPZCHZGNU-XCVCLJGOSA-N |
| XLogP | 1.74 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|