C23H23NO — CID 6273647
(E)-3-(4-tert-butylphenyl)-N-naphthalen-2-ylprop-2-enamide (PubChem CID 6273647) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-naphthalen-2-ylprop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6273647 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-naphthalen-2-ylprop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)Nc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H23NO/c1-23(2,3)20-12-8-17(9-13-20)10-15-22(25)24-21-14-11-18-6-4-5-7-19(18)16-21/h4-16H,1-3H3,(H,24,25)/b15-10+ |
| InChIKey | KUQWQGVIPNJDJR-XNTDXEJSSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|