C20H22F2N2OS — CID 4523010
N-[4-(diethylamino)phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 4523010) has the molecular formula C20H22F2N2OS and a molecular weight of 376.47 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-(diethylamino)phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4523010 |
| Molecular Formula | C20H22F2N2OS |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C=Cc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H22F2N2OS/c1-3-24(4-2)17-10-8-16(9-11-17)23-19(25)14-7-15-5-12-18(13-6-15)26-20(21)22/h5-14,20H,3-4H2,1-2H3,(H,23,25) |
| InChIKey | HBHIUTWQJCJFLB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|