C20H24N2O — CID 959463
(E)-N-[4-(diethylamino)-2-methylphenyl]-3-phenylprop-2-enamide (PubChem CID 959463) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (E)-N-[4-(diethylamino)-2-methylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-(diethylamino)-2-methylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 959463 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (E)-N-[4-(diethylamino)-2-methylphenyl]-3-phenylprop-2-enamide |
| SMILES | CCN(CC)c1ccc(NC(=O)/C=C/c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O/c1-4-22(5-2)18-12-13-19(16(3)15-18)21-20(23)14-11-17-9-7-6-8-10-17/h6-15H,4-5H2,1-3H3,(H,21,23)/b14-11+ |
| InChIKey | FWRNRAKQKFXDAF-SDNWHVSQSA-N |
| XLogP | 4.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|