C19H25ClN3O- — CID 108871335
1-benzyl-3-[4-(diethylamino)-2-methylphenyl]urea chloride (PubChem CID 108871335) has the molecular formula C19H25ClN3O- and a molecular weight of 346.88 g/mol. Its IUPAC name is 1-benzyl-3-[4-(diethylamino)-2-methylphenyl]urea chloride.
| Compound Name | 1-benzyl-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
|---|---|
| PubChem CID | 108871335 |
| Molecular Formula | C19H25ClN3O- |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-benzyl-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)NCc2ccccc2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C19H25N3O.ClH/c1-4-22(5-2)17-11-12-18(15(3)13-17)21-19(23)20-14-16-9-7-6-8-10-16;/h6-13H,4-5,14H2,1-3H3,(H2,20,21,23);1H/p-1 |
| InChIKey | DLAQZXKNIWYXMY-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|