C20H27ClN3O2- — CID 108887125
1-[4-(diethylamino)-2-methylphenyl]-3-(2-phenoxyethyl)urea chloride (PubChem CID 108887125) has the molecular formula C20H27ClN3O2- and a molecular weight of 376.91 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-methylphenyl]-3-(2-phenoxyethyl)urea chloride.
| Compound Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(2-phenoxyethyl)urea chloride |
|---|---|
| PubChem CID | 108887125 |
| Molecular Formula | C20H27ClN3O2- |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(2-phenoxyethyl)urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)NCCOc2ccccc2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C20H27N3O2.ClH/c1-4-23(5-2)17-11-12-19(16(3)15-17)22-20(24)21-13-14-25-18-9-7-6-8-10-18;/h6-12,15H,4-5,13-14H2,1-3H3,(H2,21,22,24);1H/p-1 |
| InChIKey | KCPNUNHCNGQJPU-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|