C22H31ClN3O2- — CID 108881458
1-[4-(diethylamino)-2-methylphenyl]-3-[3-(4-methylphenoxy)propyl]urea chloride (PubChem CID 108881458) has the molecular formula C22H31ClN3O2- and a molecular weight of 404.96 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-methylphenyl]-3-[3-(4-methylphenoxy)propyl]urea chloride.
| Compound Name | 1-[4-(diethylamino)-2-methylphenyl]-3-[3-(4-methylphenoxy)propyl]urea chloride |
|---|---|
| PubChem CID | 108881458 |
| Molecular Formula | C22H31ClN3O2- |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-[4-(diethylamino)-2-methylphenyl]-3-[3-(4-methylphenoxy)propyl]urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)NCCCOc2ccc(C)cc2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C22H31N3O2.ClH/c1-5-25(6-2)19-10-13-21(18(4)16-19)24-22(26)23-14-7-15-27-20-11-8-17(3)9-12-20;/h8-13,16H,5-7,14-15H2,1-4H3,(H2,23,24,26);1H/p-1 |
| InChIKey | BGSIZTAJBZWLIR-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|