C20H26FN3O2 — CID 112970527
1-[4-(diethylamino)-2-methylphenyl]-3-[2-(4-fluorophenoxy)ethyl]urea (PubChem CID 112970527) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-methylphenyl]-3-[2-(4-fluorophenoxy)ethyl]urea.
| Compound Name | 1-[4-(diethylamino)-2-methylphenyl]-3-[2-(4-fluorophenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112970527 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[4-(diethylamino)-2-methylphenyl]-3-[2-(4-fluorophenoxy)ethyl]urea |
| SMILES | CCN(CC)c1ccc(NC(=O)NCCOc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C20H26FN3O2/c1-4-24(5-2)17-8-11-19(15(3)14-17)23-20(25)22-12-13-26-18-9-6-16(21)7-10-18/h6-11,14H,4-5,12-13H2,1-3H3,(H2,22,23,25) |
| InChIKey | ZGTFORFRXMYNSF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|