C20H26Cl2N3O- — CID 108900384
1-[2-(2-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride (PubChem CID 108900384) has the molecular formula C20H26Cl2N3O- and a molecular weight of 395.35 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
|---|---|
| PubChem CID | 108900384 |
| Molecular Formula | C20H26Cl2N3O- |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)NCCc2ccccc2Cl)c(C)c1.[Cl-] |
| InChI | InChI=1S/C20H26ClN3O.ClH/c1-4-24(5-2)17-10-11-19(15(3)14-17)23-20(25)22-13-12-16-8-6-7-9-18(16)21;/h6-11,14H,4-5,12-13H2,1-3H3,(H2,22,23,25);1H/p-1 |
| InChIKey | LSVROASOVKVSOW-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|