C20H24Cl2N3O- — CID 108904848
1-[(E)-2-(2-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride (PubChem CID 108904848) has the molecular formula C20H24Cl2N3O- and a molecular weight of 393.34 g/mol. Its IUPAC name is 1-[(E)-2-(2-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride.
| Compound Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
|---|---|
| PubChem CID | 108904848 |
| Molecular Formula | C20H24Cl2N3O- |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)N/C=C/c2ccccc2Cl)c(C)c1.[Cl-] |
| InChI | InChI=1S/C20H24ClN3O.ClH/c1-4-24(5-2)17-10-11-19(15(3)14-17)23-20(25)22-13-12-16-8-6-7-9-18(16)21;/h6-14H,4-5H2,1-3H3,(H2,22,23,25);1H/p-1/b13-12+; |
| InChIKey | NLXVLTUQLIFQNM-UEIGIMKUSA-M |
| XLogP | 2.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|