C20H24ClN3O — CID 108906713
1-[(E)-2-(3-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea (PubChem CID 108906713) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea.
| Compound Name | 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 108906713 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-[4-(diethylamino)-2-methylphenyl]urea |
| SMILES | CCN(CC)c1ccc(NC(=O)N/C=C/c2cccc(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C20H24ClN3O/c1-4-24(5-2)18-9-10-19(15(3)13-18)23-20(25)22-12-11-16-7-6-8-17(21)14-16/h6-14H,4-5H2,1-3H3,(H2,22,23,25)/b12-11+ |
| InChIKey | MEZCPWSXRBLZBI-VAWYXSNFSA-N |
| XLogP | 5.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|