C18H22FN3O — CID 108894002
1-[4-(diethylamino)-2-methylphenyl]-3-(3-fluorophenyl)urea (PubChem CID 108894002) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-methylphenyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 108894002 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(3-fluorophenyl)urea |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2cccc(F)c2)c(C)c1 |
| InChI | InChI=1S/C18H22FN3O/c1-4-22(5-2)16-9-10-17(13(3)11-16)21-18(23)20-15-8-6-7-14(19)12-15/h6-12H,4-5H2,1-3H3,(H2,20,21,23) |
| InChIKey | ADFXUNHUKWFVNR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|