C18H21Cl2N3O — CID 108866430
1-(3,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea (PubChem CID 108866430) has the molecular formula C18H21Cl2N3O and a molecular weight of 366.29 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 108866430 |
| Molecular Formula | C18H21Cl2N3O |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C18H21Cl2N3O/c1-4-23(5-2)14-7-9-17(12(3)10-14)22-18(24)21-13-6-8-15(19)16(20)11-13/h6-11H,4-5H2,1-3H3,(H2,21,22,24) |
| InChIKey | UKNKHGUZZBOFAK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|