C19H21ClN4O4 — CID 108512851
N-(4-chloro-3-nitrophenyl)-N'-[4-(diethylamino)-2-methylphenyl]oxamide (PubChem CID 108512851) has the molecular formula C19H21ClN4O4 and a molecular weight of 404.85 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-N'-[4-(diethylamino)-2-methylphenyl]oxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-N'-[4-(diethylamino)-2-methylphenyl]oxamide |
|---|---|
| PubChem CID | 108512851 |
| Molecular Formula | C19H21ClN4O4 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-N'-[4-(diethylamino)-2-methylphenyl]oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C19H21ClN4O4/c1-4-23(5-2)14-7-9-16(12(3)10-14)22-19(26)18(25)21-13-6-8-15(20)17(11-13)24(27)28/h6-11H,4-5H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | IJTARVLEKODACC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|