C21H26ClN3O2 — CID 108955230
N'-(4-chloro-2-methylphenyl)-N-[4-(diethylamino)-2-methylphenyl]propanediamide (PubChem CID 108955230) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is N'-(4-chloro-2-methylphenyl)-N-[4-(diethylamino)-2-methylphenyl]propanediamide.
| Compound Name | N'-(4-chloro-2-methylphenyl)-N-[4-(diethylamino)-2-methylphenyl]propanediamide |
|---|---|
| PubChem CID | 108955230 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N'-(4-chloro-2-methylphenyl)-N-[4-(diethylamino)-2-methylphenyl]propanediamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CC(=O)Nc2ccc(Cl)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-5-25(6-2)17-8-10-19(15(4)12-17)24-21(27)13-20(26)23-18-9-7-16(22)11-14(18)3/h7-12H,5-6,13H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | XHUSQJQVDYAMJK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|