C18H22Cl2N3O- — CID 108868696
1-(4-chlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride (PubChem CID 108868696) has the molecular formula C18H22Cl2N3O- and a molecular weight of 367.30 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride.
| Compound Name | 1-(4-chlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
|---|---|
| PubChem CID | 108868696 |
| Molecular Formula | C18H22Cl2N3O- |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2ccc(Cl)cc2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C18H22ClN3O.ClH/c1-4-22(5-2)16-10-11-17(13(3)12-16)21-18(23)20-15-8-6-14(19)7-9-15;/h6-12H,4-5H2,1-3H3,(H2,20,21,23);1H/p-1 |
| InChIKey | KSTZNGVUVYJZPV-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|