C22H27ClN5O- — CID 108885688
1-[4-(diethylamino)-2-methylphenyl]-3-(2,3-dimethylquinoxalin-6-yl)urea chloride (PubChem CID 108885688) has the molecular formula C22H27ClN5O- and a molecular weight of 412.95 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-methylphenyl]-3-(2,3-dimethylquinoxalin-6-yl)urea chloride.
| Compound Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(2,3-dimethylquinoxalin-6-yl)urea chloride |
|---|---|
| PubChem CID | 108885688 |
| Molecular Formula | C22H27ClN5O- |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[4-(diethylamino)-2-methylphenyl]-3-(2,3-dimethylquinoxalin-6-yl)urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2ccc3nc(C)c(C)nc3c2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C22H27N5O.ClH/c1-6-27(7-2)18-9-11-19(14(3)12-18)26-22(28)25-17-8-10-20-21(13-17)24-16(5)15(4)23-20;/h8-13H,6-7H2,1-5H3,(H2,25,26,28);1H/p-1 |
| InChIKey | DLCJIQCNDHQOLC-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|