C15H20N4O — CID 108885600
3-(2,3-dimethylquinoxalin-6-yl)-1,1-diethylurea (PubChem CID 108885600) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-(2,3-dimethylquinoxalin-6-yl)-1,1-diethylurea.
| Compound Name | 3-(2,3-dimethylquinoxalin-6-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 108885600 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-(2,3-dimethylquinoxalin-6-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc2nc(C)c(C)nc2c1 |
| InChI | InChI=1S/C15H20N4O/c1-5-19(6-2)15(20)18-12-7-8-13-14(9-12)17-11(4)10(3)16-13/h7-9H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | ULAZERXFEAJWOW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |