C14H13N3O3 — CID 3401413
4-[(2,3-dimethylquinoxalin-6-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 3401413) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-[(2,3-dimethylquinoxalin-6-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(2,3-dimethylquinoxalin-6-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 3401413 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-[(2,3-dimethylquinoxalin-6-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | Cc1nc2ccc(NC(=O)C=CC(=O)O)cc2nc1C |
| InChI | InChI=1S/C14H13N3O3/c1-8-9(2)16-12-7-10(3-4-11(12)15-8)17-13(18)5-6-14(19)20/h3-7H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | MKPQJDSOPDIYNL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|